ojwanggideon084 ojwanggideon084

11-08-2021
Mathematics

contestada

adhiambo buys t litres of milk everyday.A litre of milk is she 25.She spends sh 3000 on milk on November.How many litres does she buy every day?

Respuesta :

suadzubydi suadzubydi

11-08-2021

3000/30=100every day

100/25=4
So she buys 4 L of milk every day.
So t=4.

Answer Link

Otras preguntas

A hydrate of CoCl2 has a mass of 17.40 g before heating. After heating, the mass of the anhydrous compound is found to be 10.27 g. Explain how you would deter

Show that cos(A+45)=cos45(cosA-sinA)

help help help help please

calculating the following: 96÷12=?

You're correctly holding an animal by its rear legs, its head between your knees, its back between your legs, and its front legs touching the ground. The animal

Katie works in a textile industry. In what sector does Katie work?

review the main idea Mary Cassatt blazed a trail for future female artists which identifies and explains a detail that supports this main idea a. Mary Cassatt w

Which kind of tax is paid when purchasing consumer goods and services?

A 65.0-gram sample of some unknown metal at 100.0° C is added to 177.1 grams of water at 24.5° C. The temperature of the water rises to 27.0° C. If the specific

Solid Lithium chloride decomposes into chlorine gas and solid lithium. What's the balanced equation for this reaction?